C9H7F13O — CID 58451690
2-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane (PubChem CID 58451690) has the molecular formula C9H7F13O and a molecular weight of 378.13 g/mol. Its IUPAC name is 2-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane.
| Compound Name | 2-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane |
|---|---|
| PubChem CID | 58451690 |
| Molecular Formula | C9H7F13O |
| Molecular Weight | 378.13 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-1,1,1,4,5,5,5-heptafluoropentane |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C(CC(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H7F13O/c1-5(11,12)9(21,22)23-8(19,20)3(6(13,14)15)2-4(10)7(16,17)18/h3-4H,2H2,1H3 |
| InChIKey | ZIYFWZPILLSQGX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.13 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|