About 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate
4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate (PubChem CID 58451776) has the molecular formula C14H25NO4
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate.
Molecular Properties
| Compound Name | 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate |
| PubChem CID | 58451776 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate |
| SMILES | CCC(=O)NCCCCOC(=O)/C=C/COC(C)C |
| InChI | InChI=1S/C14H25NO4/c1-4-13(16)15-9-5-6-10-19-14(17)8-7-11-18-12(2)3/h7-8,12H,4-6,9-11H2,1-3H3,(H,15,16)/b8-7+ |
| InChIKey | XJELPGSKCVCGGU-BQYQJAHWSA-N |
| XLogP | 1.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate?
The IUPAC name of 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate (CID 58451776) is 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate.
What is the SMILES notation for 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate?
The canonical SMILES for 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate is CCC(=O)NCCCCOC(=O)/C=C/COC(C)C.
What is the InChIKey of 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate?
The InChIKey is XJELPGSKCVCGGU-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H25NO4/c1-4-13(16)15-9-5-6-10-19-14(17)8-7-11-18-12(2)3/h7-8,12H,4-6,9-11H2,1-3H3,(H,15,16)/b8-7+.
What are the key properties of 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate?
4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate has a molecular weight of 271.36 g/mol, XLogP of 1.82, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(propanoylamino)butyl (E)-4-propan-2-yloxybut-2-enoate is sourced from PubChem (CID 58451776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).