C23H26Cl2N2O3 — CID 58452440
3-chloro-6-[(E)-1-[3-chloro-4-(4-methylpentoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one (PubChem CID 58452440) has the molecular formula C23H26Cl2N2O3 and a molecular weight of 449.38 g/mol. Its IUPAC name is 3-chloro-6-[(E)-1-[3-chloro-4-(4-methylpentoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one.
| Compound Name | 3-chloro-6-[(E)-1-[3-chloro-4-(4-methylpentoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 58452440 |
| Molecular Formula | C23H26Cl2N2O3 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 3-chloro-6-[(E)-1-[3-chloro-4-(4-methylpentoxy)phenyl]-2-[(2R)-5-oxopyrrolidin-2-yl]ethenyl]-1H-pyridin-2-one |
| SMILES | CC(C)CCCOc1ccc(/C(=C\[C@H]2CCC(=O)N2)c2ccc(Cl)c(=O)[nH]2)cc1Cl |
| InChI | InChI=1S/C23H26Cl2N2O3/c1-14(2)4-3-11-30-21-9-5-15(12-19(21)25)17(13-16-6-10-22(28)26-16)20-8-7-18(24)23(29)27-20/h5,7-9,12-14,16H,3-4,6,10-11H2,1-2H3,(H,26,28)(H,27,29)/b17-13+/t16-/m1/s1 |
| InChIKey | YWNWWCYCBWZGJC-VAFHRPCXSA-N |
| XLogP | 5.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|