C28H30N2OS — CID 58452947
S-methyl N-[(4S,10S)-4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate (PubChem CID 58452947) has the molecular formula C28H30N2OS and a molecular weight of 442.63 g/mol. Its IUPAC name is S-methyl N-[(4S,10S)-4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate.
| Compound Name | S-methyl N-[(4S,10S)-4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate |
|---|---|
| PubChem CID | 58452947 |
| Molecular Formula | C28H30N2OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | S-methyl N-[(4S,10S)-4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamothioate |
| SMILES | CSC(=O)Nc1cc2c3c(c1)[C@H](c1ccc(C)cc1)CCN3CC[C@H]2c1ccc(C)cc1 |
| InChI | InChI=1S/C28H30N2OS/c1-18-4-8-20(9-5-18)23-12-14-30-15-13-24(21-10-6-19(2)7-11-21)26-17-22(29-28(31)32-3)16-25(23)27(26)30/h4-11,16-17,23-24H,12-15H2,1-3H3,(H,29,31)/t23-,24-/m0/s1 |
| InChIKey | FSYXYIXOEKGBKD-ZEQRLZLVSA-N |
| XLogP | 7.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|