C31H36N2O2 — CID 58452983
butyl N-[4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate (PubChem CID 58452983) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is butyl N-[4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate.
| Compound Name | butyl N-[4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
|---|---|
| PubChem CID | 58452983 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | butyl N-[4,10-bis(4-methylphenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1cc2c3c(c1)C(c1ccc(C)cc1)CCN3CCC2c1ccc(C)cc1 |
| InChI | InChI=1S/C31H36N2O2/c1-4-5-18-35-31(34)32-25-19-28-26(23-10-6-21(2)7-11-23)14-16-33-17-15-27(29(20-25)30(28)33)24-12-8-22(3)9-13-24/h6-13,19-20,26-27H,4-5,14-18H2,1-3H3,(H,32,34) |
| InChIKey | WONUXAOXKDDWMG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|