C26H24Cl2N2O2 — CID 58452997
methyl N-[(4R,10S)-4,10-bis(3-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate (PubChem CID 58452997) has the molecular formula C26H24Cl2N2O2 and a molecular weight of 467.40 g/mol. Its IUPAC name is methyl N-[(4R,10S)-4,10-bis(3-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate.
| Compound Name | methyl N-[(4R,10S)-4,10-bis(3-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
|---|---|
| PubChem CID | 58452997 |
| Molecular Formula | C26H24Cl2N2O2 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | methyl N-[(4R,10S)-4,10-bis(3-chlorophenyl)-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl]carbamate |
| SMILES | COC(=O)Nc1cc2c3c(c1)[C@H](c1cccc(Cl)c1)CCN3CC[C@@H]2c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H24Cl2N2O2/c1-32-26(31)29-20-14-23-21(16-4-2-6-18(27)12-16)8-10-30-11-9-22(24(15-20)25(23)30)17-5-3-7-19(28)13-17/h2-7,12-15,21-22H,8-11H2,1H3,(H,29,31)/t21-,22+ |
| InChIKey | IAOMSAVDNWRQLW-SZPZYZBQSA-N |
| XLogP | 7.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|