C38H32N2O4S2 — CID 58453141
[6-[cyano(isocyano)methylidene]-9-(cyclohexanecarbonyloxy)-5,7-dithiahexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2(10),3,8,12,14,16,18,20,22-nonaen-3-yl] cyclohexanecarboxylate (PubChem CID 58453141) has the molecular formula C38H32N2O4S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is [6-[cyano(isocyano)methylidene]-9-(cyclohexanecarbonyloxy)-5,7-dithiahexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2(10),3,8,12,14,16,18,20,22-nonaen-3-yl] cyclohexanecarboxylate.
| Compound Name | [6-[cyano(isocyano)methylidene]-9-(cyclohexanecarbonyloxy)-5,7-dithiahexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2(10),3,8,12,14,16,18,20,22-nonaen-3-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 58453141 |
| Molecular Formula | C38H32N2O4S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | [6-[cyano(isocyano)methylidene]-9-(cyclohexanecarbonyloxy)-5,7-dithiahexacyclo[9.6.6.02,10.04,8.012,17.018,23]tricosa-2(10),3,8,12,14,16,18,20,22-nonaen-3-yl] cyclohexanecarboxylate |
| SMILES | [C-]#[N+]C(C#N)=C1Sc2c(OC(=O)C3CCCCC3)c3c(c(OC(=O)C4CCCCC4)c2S1)C1c2ccccc2C3c2ccccc21 |
| InChI | InChI=1S/C38H32N2O4S2/c1-40-27(20-39)38-45-34-32(43-36(41)21-12-4-2-5-13-21)30-28-23-16-8-10-18-25(23)29(26-19-11-9-17-24(26)28)31(30)33(35(34)46-38)44-37(42)22-14-6-3-7-15-22/h8-11,16-19,21-22,28-29H,2-7,12-15H2 |
| InChIKey | AGISGNKPOPDGIS-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|