C52H62O10 — CID 58453487
[2-[3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate (PubChem CID 58453487) has the molecular formula C52H62O10 and a molecular weight of 847.06 g/mol. Its IUPAC name is [2-[3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate.
| Compound Name | [2-[3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 58453487 |
| Molecular Formula | C52H62O10 |
| Molecular Weight | 847.06 g/mol |
| Exact Mass | 846.43 |
| IUPAC Name | [2-[3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-1,2-diphenylethyl] 3-methyl-4-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
| SMILES | Cc1cc(C(=O)OC(c2ccccc2)C(OC(=O)c2ccc(OCCCCOCC3CCC4OC4C3)c(C)c2)c2ccccc2)ccc1OCCCCOCC1CCC2OC2C1 |
| InChI | InChI=1S/C52H62O10/c1-35-29-41(19-23-43(35)57-27-11-9-25-55-33-37-17-21-45-47(31-37)59-45)51(53)61-49(39-13-5-3-6-14-39)50(40-15-7-4-8-16-40)62-52(54)42-20-24-44(36(2)30-42)58-28-12-10-26-56-34-38-18-22-46-48(32-38)60-46/h3-8,13-16,19-20,23-24,29-30,37-38,45-50H,9-12,17-18,21-22,25-28,31-34H2,1-2H3 |
| InChIKey | QVUGLGSJZLHQCH-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.06 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|