C38H44F4O2 — CID 58453665
[4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-pentylphenyl)benzoate (PubChem CID 58453665) has the molecular formula C38H44F4O2 and a molecular weight of 608.76 g/mol. Its IUPAC name is [4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-pentylphenyl)benzoate.
| Compound Name | [4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-pentylphenyl)benzoate |
|---|---|
| PubChem CID | 58453665 |
| Molecular Formula | C38H44F4O2 |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | [4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]cyclohexyl] 4-(2,3-difluoro-4-pentylphenyl)benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)OC3CCC(C4CCC(c5ccc(CC)c(F)c5F)CC4)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C38H44F4O2/c1-3-5-6-7-29-19-23-33(37(42)35(29)40)28-12-14-30(15-13-28)38(43)44-31-20-16-26(17-21-31)25-8-10-27(11-9-25)32-22-18-24(4-2)34(39)36(32)41/h12-15,18-19,22-23,25-27,31H,3-11,16-17,20-21H2,1-2H3 |
| InChIKey | IYQMYYSNFLOFAA-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|