C38H42F6O2 — CID 58453713
[4-(2,3-difluoro-4-pentylphenyl)cyclohexyl] 4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzoate (PubChem CID 58453713) has the molecular formula C38H42F6O2 and a molecular weight of 644.74 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-pentylphenyl)cyclohexyl] 4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzoate.
| Compound Name | [4-(2,3-difluoro-4-pentylphenyl)cyclohexyl] 4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 58453713 |
| Molecular Formula | C38H42F6O2 |
| Molecular Weight | 644.74 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | [4-(2,3-difluoro-4-pentylphenyl)cyclohexyl] 4-[4-(4-ethyl-2,3-difluorophenyl)cyclohexyl]-2,3-difluorobenzoate |
| SMILES | CCCCCc1ccc(C2CCC(OC(=O)c3ccc(C4CCC(c5ccc(CC)c(F)c5F)CC4)c(F)c3F)CC2)c(F)c1F |
| InChI | InChI=1S/C38H42F6O2/c1-3-5-6-7-26-15-19-29(35(42)33(26)40)25-12-16-27(17-13-25)46-38(45)31-21-20-30(36(43)37(31)44)24-10-8-23(9-11-24)28-18-14-22(4-2)32(39)34(28)41/h14-15,18-21,23-25,27H,3-13,16-17H2,1-2H3 |
| InChIKey | LHJSGRKMMKUEQV-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.74 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|