C56H46N6 — CID 58454329
2-[12-[4,6-bis(2,6-dimethylphenyl)-1,3,5-triazin-2-yl]chrysen-6-yl]-4,6-bis(2,6-dimethylphenyl)-1,3,5-triazine (PubChem CID 58454329) has the molecular formula C56H46N6 and a molecular weight of 803.03 g/mol. Its IUPAC name is 2-[12-[4,6-bis(2,6-dimethylphenyl)-1,3,5-triazin-2-yl]chrysen-6-yl]-4,6-bis(2,6-dimethylphenyl)-1,3,5-triazine.
| Compound Name | 2-[12-[4,6-bis(2,6-dimethylphenyl)-1,3,5-triazin-2-yl]chrysen-6-yl]-4,6-bis(2,6-dimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58454329 |
| Molecular Formula | C56H46N6 |
| Molecular Weight | 803.03 g/mol |
| Exact Mass | 802.38 |
| IUPAC Name | 2-[12-[4,6-bis(2,6-dimethylphenyl)-1,3,5-triazin-2-yl]chrysen-6-yl]-4,6-bis(2,6-dimethylphenyl)-1,3,5-triazine |
| SMILES | Cc1cccc(C)c1-c1nc(-c2c(C)cccc2C)nc(-c2cc3c4ccccc4c(-c4nc(-c5c(C)cccc5C)nc(-c5c(C)cccc5C)n4)cc3c3ccccc23)n1 |
| InChI | InChI=1S/C56H46N6/c1-31-17-13-18-32(2)47(31)53-57-51(58-54(61-53)48-33(3)19-14-20-34(48)4)45-29-43-40-26-10-12-28-42(40)46(30-44(43)39-25-9-11-27-41(39)45)52-59-55(49-35(5)21-15-22-36(49)6)62-56(60-52)50-37(7)23-16-24-38(50)8/h9-30H,1-8H3 |
| InChIKey | KFJRDXKHHZJRAB-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.03 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|