C58H52N6 — CID 58454357
2-[6-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazine (PubChem CID 58454357) has the molecular formula C58H52N6 and a molecular weight of 833.10 g/mol. Its IUPAC name is 2-[6-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazine.
| Compound Name | 2-[6-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58454357 |
| Molecular Formula | C58H52N6 |
| Molecular Weight | 833.10 g/mol |
| Exact Mass | 832.43 |
| IUPAC Name | 2-[6-[4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-4,6-bis(2,4,6-trimethylphenyl)-1,3,5-triazine |
| SMILES | Cc1cc(C)c(-c2nc(-c3c(C)cc(C)cc3C)nc(-c3ccc4ccc5c(-c6nc(-c7c(C)cc(C)cc7C)nc(-c7c(C)cc(C)cc7C)n6)ccc6ccc3c4c65)n2)c(C)c1 |
| InChI | InChI=1S/C58H52N6/c1-29-21-33(5)47(34(6)22-29)55-59-53(60-56(63-55)48-35(7)23-30(2)24-36(48)8)45-19-15-41-14-18-44-46(20-16-42-13-17-43(45)51(41)52(42)44)54-61-57(49-37(9)25-31(3)26-38(49)10)64-58(62-54)50-39(11)27-32(4)28-40(50)12/h13-28H,1-12H3 |
| InChIKey | ZAMULXBAGOFNMX-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.10 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|