About 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium
1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium (PubChem CID 58454374) has the molecular formula C11H12IrN2
and a molecular weight of 364.45 g/mol. Its IUPAC name is 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium.
Molecular Properties
| Compound Name | 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium |
| PubChem CID | 58454374 |
| Molecular Formula | C11H12IrN2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium |
| SMILES | CC1N=C(c2[c-]cccc2)C=[N+]1C.[Ir] |
| InChI | InChI=1S/C11H12N2.Ir/c1-9-12-11(8-13(9)2)10-6-4-3-5-7-10;/h3-6,8-9H,1-2H3; |
| InChIKey | KYGHSARIMDRKRT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium?
The IUPAC name of 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium (CID 58454374) is 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium.
What is the SMILES notation for 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium?
The canonical SMILES for 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium is CC1N=C(c2[c-]cccc2)C=[N+]1C.[Ir].
What is the InChIKey of 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium?
The InChIKey is KYGHSARIMDRKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.Ir/c1-9-12-11(8-13(9)2)10-6-4-3-5-7-10;/h3-6,8-9H,1-2H3;.
What are the key properties of 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium?
1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium has a molecular weight of 364.45 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4-phenyl-2H-imidazol-1-ium;iridium is sourced from PubChem (CID 58454374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).