About 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one
9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one (PubChem CID 58454388) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one.
Molecular Properties
| Compound Name | 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one |
| PubChem CID | 58454388 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one |
| SMILES | CC(=O)CCCC(C)(C)CC(C)CN[C@@H](C)O |
| InChI | InChI=1S/C14H29NO2/c1-11(10-15-13(3)17)9-14(4,5)8-6-7-12(2)16/h11,13,15,17H,6-10H2,1-5H3/t11?,13-/m1/s1 |
| InChIKey | ISSZHGGIZMMOMF-GLGOKHISSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one?
The IUPAC name of 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one (CID 58454388) is 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one.
What is the SMILES notation for 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one?
The canonical SMILES for 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one is CC(=O)CCCC(C)(C)CC(C)CN[C@@H](C)O.
What is the InChIKey of 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one?
The InChIKey is ISSZHGGIZMMOMF-GLGOKHISSA-N. The full InChI is InChI=1S/C14H29NO2/c1-11(10-15-13(3)17)9-14(4,5)8-6-7-12(2)16/h11,13,15,17H,6-10H2,1-5H3/t11?,13-/m1/s1.
What are the key properties of 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one?
9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one has a molecular weight of 243.39 g/mol, XLogP of 2.73, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[[(1R)-1-hydroxyethyl]amino]-6,6,8-trimethylnonan-2-one is sourced from PubChem (CID 58454388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).