About 1-ethenoxy-2,3-dimethoxypropane
1-ethenoxy-2,3-dimethoxypropane (PubChem CID 58454460) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-ethenoxy-2,3-dimethoxypropane.
Molecular Properties
| Compound Name | 1-ethenoxy-2,3-dimethoxypropane |
| PubChem CID | 58454460 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 1-ethenoxy-2,3-dimethoxypropane |
| SMILES | C=COCC(COC)OC |
| InChI | InChI=1S/C7H14O3/c1-4-10-6-7(9-3)5-8-2/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | NOOQSWQJIUDQLG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-2,3-dimethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-2,3-dimethoxypropane?
The IUPAC name of 1-ethenoxy-2,3-dimethoxypropane (CID 58454460) is 1-ethenoxy-2,3-dimethoxypropane.
What is the SMILES notation for 1-ethenoxy-2,3-dimethoxypropane?
The canonical SMILES for 1-ethenoxy-2,3-dimethoxypropane is C=COCC(COC)OC.
What is the InChIKey of 1-ethenoxy-2,3-dimethoxypropane?
The InChIKey is NOOQSWQJIUDQLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-4-10-6-7(9-3)5-8-2/h4,7H,1,5-6H2,2-3H3.
What are the key properties of 1-ethenoxy-2,3-dimethoxypropane?
1-ethenoxy-2,3-dimethoxypropane has a molecular weight of 146.19 g/mol, XLogP of 0.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-2,3-dimethoxypropane is sourced from PubChem (CID 58454460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).