C15H20F9NO — CID 58454465
N-butyl-2-methylidene-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)butanamide (PubChem CID 58454465) has the molecular formula C15H20F9NO and a molecular weight of 401.31 g/mol. Its IUPAC name is N-butyl-2-methylidene-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)butanamide.
| Compound Name | N-butyl-2-methylidene-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)butanamide |
|---|---|
| PubChem CID | 58454465 |
| Molecular Formula | C15H20F9NO |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-butyl-2-methylidene-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)butanamide |
| SMILES | C=C(CC)C(=O)N(CCCC)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F9NO/c1-4-6-8-25(11(26)10(3)5-2)9-7-12(16,17)13(18,19)14(20,21)15(22,23)24/h3-9H2,1-2H3 |
| InChIKey | FOONREXOLRWRRN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|