C20H13Cl6N3O — CID 58454526
[4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]methanol (PubChem CID 58454526) has the molecular formula C20H13Cl6N3O and a molecular weight of 524.06 g/mol. Its IUPAC name is [4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]methanol.
| Compound Name | [4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 58454526 |
| Molecular Formula | C20H13Cl6N3O |
| Molecular Weight | 524.06 g/mol |
| Exact Mass | 520.92 |
| IUPAC Name | [4-[2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]ethenyl]phenyl]methanol |
| SMILES | OCc1ccc(C=Cc2ccc(-c3nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n3)cc2)cc1 |
| InChI | InChI=1S/C20H13Cl6N3O/c21-19(22,23)17-27-16(28-18(29-17)20(24,25)26)15-9-7-13(8-10-15)2-1-12-3-5-14(11-30)6-4-12/h1-10,30H,11H2 |
| InChIKey | ARISSGPRGXEZGL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.06 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|