About 2-methoxyethyl 5-methoxypentanoate
2-methoxyethyl 5-methoxypentanoate (PubChem CID 58454735) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-methoxyethyl 5-methoxypentanoate.
Molecular Properties
| Compound Name | 2-methoxyethyl 5-methoxypentanoate |
| PubChem CID | 58454735 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-methoxyethyl 5-methoxypentanoate |
| SMILES | COCCCCC(=O)OCCOC |
| InChI | InChI=1S/C9H18O4/c1-11-6-4-3-5-9(10)13-8-7-12-2/h3-8H2,1-2H3 |
| InChIKey | LTGZHKMZTJYCLT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 5-methoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 5-methoxypentanoate?
The IUPAC name of 2-methoxyethyl 5-methoxypentanoate (CID 58454735) is 2-methoxyethyl 5-methoxypentanoate.
What is the SMILES notation for 2-methoxyethyl 5-methoxypentanoate?
The canonical SMILES for 2-methoxyethyl 5-methoxypentanoate is COCCCCC(=O)OCCOC.
What is the InChIKey of 2-methoxyethyl 5-methoxypentanoate?
The InChIKey is LTGZHKMZTJYCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-11-6-4-3-5-9(10)13-8-7-12-2/h3-8H2,1-2H3.
What are the key properties of 2-methoxyethyl 5-methoxypentanoate?
2-methoxyethyl 5-methoxypentanoate has a molecular weight of 190.24 g/mol, XLogP of 0.99, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 5-methoxypentanoate is sourced from PubChem (CID 58454735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).