C35H41N3S+2 — CID 58454893
trimethyl-[3-[4-[(E)-2-[4-[4-(sulfanylmethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]quinolin-1-ium-1-yl]propyl]azanium (PubChem CID 58454893) has the molecular formula C35H41N3S+2 and a molecular weight of 535.80 g/mol. Its IUPAC name is trimethyl-[3-[4-[(E)-2-[4-[4-(sulfanylmethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]quinolin-1-ium-1-yl]propyl]azanium.
| Compound Name | trimethyl-[3-[4-[(E)-2-[4-[4-(sulfanylmethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]quinolin-1-ium-1-yl]propyl]azanium |
|---|---|
| PubChem CID | 58454893 |
| Molecular Formula | C35H41N3S+2 |
| Molecular Weight | 535.80 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | trimethyl-[3-[4-[(E)-2-[4-[4-(sulfanylmethyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]quinolin-1-ium-1-yl]propyl]azanium |
| SMILES | C[N+](C)(C)CCC[n+]1ccc(/C=C/c2ccc3c(c2)C2CCCC2N3c2ccc(CS)cc2)c2ccccc21 |
| InChI | InChI=1S/C35H40N3S/c1-38(2,3)23-7-21-36-22-20-28(30-8-4-5-10-33(30)36)16-12-26-15-19-35-32(24-26)31-9-6-11-34(31)37(35)29-17-13-27(25-39)14-18-29/h4-5,8,10,12-20,22,24,31,34H,6-7,9,11,21,23,25H2,1-3H3/q+1/p+1 |
| InChIKey | LIZJLMGBEKEVGC-UHFFFAOYSA-O |
| XLogP | 7.61 |
| TPSA | 7.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.80 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|