C25H25N3O4 — CID 58454905
[(5E)-2-ethylimino-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-oxazolidin-3-yl]methyl formate (PubChem CID 58454905) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is [(5E)-2-ethylimino-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-oxazolidin-3-yl]methyl formate.
| Compound Name | [(5E)-2-ethylimino-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-oxazolidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 58454905 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | [(5E)-2-ethylimino-4-oxo-5-[(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)methylidene]-1,3-oxazolidin-3-yl]methyl formate |
| SMILES | CC/N=C1\O/C(=C/c2ccc3c(c2)C2CCCC2N3c2ccccc2)C(=O)N1COC=O |
| InChI | InChI=1S/C25H25N3O4/c1-2-26-25-27(15-31-16-29)24(30)23(32-25)14-17-11-12-22-20(13-17)19-9-6-10-21(19)28(22)18-7-4-3-5-8-18/h3-5,7-8,11-14,16,19,21H,2,6,9-10,15H2,1H3/b23-14+,26-25- |
| InChIKey | MKPHROJDGGHYHZ-WRIATZMJSA-N |
| XLogP | 4.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|