C46H38N2NaO2S2+ — CID 58454920
sodium 2-[2-[(E)-2-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethanesulfinate (PubChem CID 58454920) has the molecular formula C46H38N2NaO2S2+ and a molecular weight of 737.95 g/mol. Its IUPAC name is sodium 2-[2-[(E)-2-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethanesulfinate.
| Compound Name | sodium 2-[2-[(E)-2-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethanesulfinate |
|---|---|
| PubChem CID | 58454920 |
| Molecular Formula | C46H38N2NaO2S2+ |
| Molecular Weight | 737.95 g/mol |
| Exact Mass | 737.23 |
| IUPAC Name | sodium 2-[2-[(E)-2-[4-[4-(2,2-diphenylethenyl)phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]ethenyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethanesulfinate |
| SMILES | O=S([O-])CC[n+]1c(/C=C/c2ccc3c(c2)C2CCCC2N3c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)sc2c3ccccc3ccc21.[Na+] |
| InChI | InChI=1S/C46H38N2O2S2.Na/c49-52(50)29-28-47-44-26-22-36-14-7-8-15-38(36)46(44)51-45(47)27-21-33-20-25-43-41(31-33)39-16-9-17-42(39)48(43)37-23-18-32(19-24-37)30-40(34-10-3-1-4-11-34)35-12-5-2-6-13-35;/h1-8,10-15,18-27,30-31,39,42H,9,16-17,28-29H2;/q;+1 |
| InChIKey | KUURGYVYKVUBMT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.95 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|