C39H72N6O12 — CID 58455229
methyl 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate (PubChem CID 58455229) has the molecular formula C39H72N6O12 and a molecular weight of 817.03 g/mol. Its IUPAC name is methyl 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate.
| Compound Name | methyl 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 58455229 |
| Molecular Formula | C39H72N6O12 |
| Molecular Weight | 817.03 g/mol |
| Exact Mass | 816.52 |
| IUPAC Name | methyl 2,6-bis[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)NC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H72N6O12/c1-36(2,3)54-32(49)41-24-18-14-20-26(44-34(51)56-38(7,8)9)29(46)40-23-17-16-22-28(31(48)53-13)43-30(47)27(45-35(52)57-39(10,11)12)21-15-19-25-42-33(50)55-37(4,5)6/h26-28H,14-25H2,1-13H3,(H,40,46)(H,41,49)(H,42,50)(H,43,47)(H,44,51)(H,45,52) |
| InChIKey | MYMQYKWMCNWLJC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 237.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.03 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|