C13H16F6O4 — CID 58455654
[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxycyclohexyl] 2-methylprop-2-enoate (PubChem CID 58455654) has the molecular formula C13H16F6O4 and a molecular weight of 350.26 g/mol. Its IUPAC name is [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxycyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxycyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58455654 |
| Molecular Formula | C13H16F6O4 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-hydroxycyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(O)C(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H16F6O4/c1-6(2)10(21)23-7-3-4-9(20)8(5-7)11(22,12(14,15)16)13(17,18)19/h7-9,20,22H,1,3-5H2,2H3 |
| InChIKey | VZRVPLJXARKPHF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|