C13H19F3O4 — CID 58455659
[3-hydroxy-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate (PubChem CID 58455659) has the molecular formula C13H19F3O4 and a molecular weight of 296.29 g/mol. Its IUPAC name is [3-hydroxy-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58455659 |
| Molecular Formula | C13H19F3O4 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [3-hydroxy-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(C(C)(O)C(F)(F)F)C(O)C1 |
| InChI | InChI=1S/C13H19F3O4/c1-7(2)11(18)20-8-4-5-9(10(17)6-8)12(3,19)13(14,15)16/h8-10,17,19H,1,4-6H2,2-3H3 |
| InChIKey | XULOOKQFOGIZGN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|