C24H23F9N2O4S — CID 58455673
2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl N-[4-[(4-prop-1-en-2-ylphenyl)methyl]phenyl]carbamate (PubChem CID 58455673) has the molecular formula C24H23F9N2O4S and a molecular weight of 606.51 g/mol. Its IUPAC name is 2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl N-[4-[(4-prop-1-en-2-ylphenyl)methyl]phenyl]carbamate.
| Compound Name | 2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl N-[4-[(4-prop-1-en-2-ylphenyl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 58455673 |
| Molecular Formula | C24H23F9N2O4S |
| Molecular Weight | 606.51 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl N-[4-[(4-prop-1-en-2-ylphenyl)methyl]phenyl]carbamate |
| SMILES | C=C(C)c1ccc(Cc2ccc(NC(=O)OCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H23F9N2O4S/c1-15(2)18-8-4-16(5-9-18)14-17-6-10-19(11-7-17)34-20(36)39-13-12-35(3)40(37,38)24(32,33)22(27,28)21(25,26)23(29,30)31/h4-11H,1,12-14H2,2-3H3,(H,34,36) |
| InChIKey | KQYRGVWRAXRJKI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|