C25H24F3O3S+ — CID 58455739
[3,5-dimethyl-4-[2-oxo-2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]-diphenylsulfanium (PubChem CID 58455739) has the molecular formula C25H24F3O3S+ and a molecular weight of 461.53 g/mol. Its IUPAC name is [3,5-dimethyl-4-[2-oxo-2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-[2-oxo-2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58455739 |
| Molecular Formula | C25H24F3O3S+ |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | [3,5-dimethyl-4-[2-oxo-2-(3,3,3-trifluoropropoxy)ethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C25H24F3O3S/c1-18-15-22(32(20-9-5-3-6-10-20)21-11-7-4-8-12-21)16-19(2)24(18)31-17-23(29)30-14-13-25(26,27)28/h3-12,15-16H,13-14,17H2,1-2H3/q+1 |
| InChIKey | ONLGHQDIMFVKHY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|