C28H30Cl2N2O2 — CID 58455876
1,4-bis(4-chlorophenyl)-2,5-bis(2-methylbutan-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 58455876) has the molecular formula C28H30Cl2N2O2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 1,4-bis(4-chlorophenyl)-2,5-bis(2-methylbutan-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis(4-chlorophenyl)-2,5-bis(2-methylbutan-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 58455876 |
| Molecular Formula | C28H30Cl2N2O2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1,4-bis(4-chlorophenyl)-2,5-bis(2-methylbutan-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCC(C)(C)N1C(=O)C2=C(c3ccc(Cl)cc3)N(C(C)(C)CC)C(=O)C2=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H30Cl2N2O2/c1-7-27(3,4)31-23(17-9-13-19(29)14-10-17)21-22(25(31)33)24(18-11-15-20(30)16-12-18)32(26(21)34)28(5,6)8-2/h9-16H,7-8H2,1-6H3 |
| InChIKey | APSODUBDVJCJRW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|