C12H24OS — CID 58456259
2,2,6,6-tetramethyl-4-propan-2-ylthian-4-ol (PubChem CID 58456259) has the molecular formula C12H24OS and a molecular weight of 216.39 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-propan-2-ylthian-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-4-propan-2-ylthian-4-ol |
|---|---|
| PubChem CID | 58456259 |
| Molecular Formula | C12H24OS |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-propan-2-ylthian-4-ol |
| SMILES | CC(C)C1(O)CC(C)(C)SC(C)(C)C1 |
| InChI | InChI=1S/C12H24OS/c1-9(2)12(13)7-10(3,4)14-11(5,6)8-12/h9,13H,7-8H2,1-6H3 |
| InChIKey | ONMPGLWYEAURAD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |