About 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol
1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol (PubChem CID 58456326) has the molecular formula C5H4BrF2NOS
and a molecular weight of 244.06 g/mol. Its IUPAC name is 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol |
| PubChem CID | 58456326 |
| Molecular Formula | C5H4BrF2NOS |
| Molecular Weight | 244.06 g/mol |
| Exact Mass | 242.92 |
| IUPAC Name | 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol |
| SMILES | OC(c1ncc(Br)s1)C(F)F |
| InChI | InChI=1S/C5H4BrF2NOS/c6-2-1-9-5(11-2)3(10)4(7)8/h1,3-4,10H |
| InChIKey | WZMSZCOKSIINAI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.06 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol?
The IUPAC name of 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol (CID 58456326) is 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol.
What is the SMILES notation for 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol?
The canonical SMILES for 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol is OC(c1ncc(Br)s1)C(F)F.
What is the InChIKey of 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol?
The InChIKey is WZMSZCOKSIINAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrF2NOS/c6-2-1-9-5(11-2)3(10)4(7)8/h1,3-4,10H.
What are the key properties of 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol?
1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol has a molecular weight of 244.06 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-1,3-thiazol-2-yl)-2,2-difluoroethanol is sourced from PubChem (CID 58456326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).