C17H18BBrF3N3O2 — CID 58456329
N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 58456329) has the molecular formula C17H18BBrF3N3O2 and a molecular weight of 444.06 g/mol. Its IUPAC name is N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 58456329 |
| Molecular Formula | C17H18BBrF3N3O2 |
| Molecular Weight | 444.06 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N-[3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC1(C)OB(c2cc(Br)cc(Nc3nccc(C(F)(F)F)n3)c2)OC1(C)C |
| InChI | InChI=1S/C17H18BBrF3N3O2/c1-15(2)16(3,4)27-18(26-15)10-7-11(19)9-12(8-10)24-14-23-6-5-13(25-14)17(20,21)22/h5-9H,1-4H3,(H,23,24,25) |
| InChIKey | NEGKMFUWJNRJKO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|