methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate

C13H10BrNO2S — CID 58456378

IUPACmethyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate
SMILESC=C(c1ccc(C(=O)OC)cc1)c1ncc(Br)s1
InChIInChI=1S/C13H10BrNO2S/c1-8(12-15-7-11(14)18-12)9-3-5-10(6-4-9)13(16)17-2/h3-7H,1H2,2H3
InChIKeyASKDALSMTOHZKP-UHFFFAOYSA-N
MW324.20 g/mol
LogP3.75
Rot. Bonds3

About methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate

methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate (PubChem CID 58456378) has the molecular formula C13H10BrNO2S and a molecular weight of 324.20 g/mol. Its IUPAC name is methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate
PubChem CID58456378
Molecular FormulaC13H10BrNO2S
Molecular Weight324.20 g/mol
Exact Mass322.96
IUPAC Namemethyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate
SMILESC=C(c1ccc(C(=O)OC)cc1)c1ncc(Br)s1
InChIInChI=1S/C13H10BrNO2S/c1-8(12-15-7-11(14)18-12)9-3-5-10(6-4-9)13(16)17-2/h3-7H,1H2,2H3
InChIKeyASKDALSMTOHZKP-UHFFFAOYSA-N
XLogP3.75
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.20
LogP ≤ 53.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate?
The IUPAC name of methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate (CID 58456378) is methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate.
What is the SMILES notation for methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate?
The canonical SMILES for methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate is C=C(c1ccc(C(=O)OC)cc1)c1ncc(Br)s1.
What is the InChIKey of methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate?
The InChIKey is ASKDALSMTOHZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrNO2S/c1-8(12-15-7-11(14)18-12)9-3-5-10(6-4-9)13(16)17-2/h3-7H,1H2,2H3.
What are the key properties of methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate?
methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate has a molecular weight of 324.20 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[1-(5-bromo-1,3-thiazol-2-yl)ethenyl]benzoate is sourced from PubChem (CID 58456378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).