C14H16F2N2O3 — CID 58456583
2-butyl-1-(2,2-difluoroethyl)-8H-1,6-naphthyridine-4,5,7-trione (PubChem CID 58456583) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-butyl-1-(2,2-difluoroethyl)-8H-1,6-naphthyridine-4,5,7-trione.
| Compound Name | 2-butyl-1-(2,2-difluoroethyl)-8H-1,6-naphthyridine-4,5,7-trione |
|---|---|
| PubChem CID | 58456583 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-butyl-1-(2,2-difluoroethyl)-8H-1,6-naphthyridine-4,5,7-trione |
| SMILES | CCCCc1cc(=O)c2c(n1CC(F)F)CC(=O)NC2=O |
| InChI | InChI=1S/C14H16F2N2O3/c1-2-3-4-8-5-10(19)13-9(18(8)7-11(15)16)6-12(20)17-14(13)21/h5,11H,2-4,6-7H2,1H3,(H,17,20,21) |
| InChIKey | VWJJCTDGQTURCX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|