C17H22F2N2O3 — CID 58456587
1-butyl-2-(5,5-difluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione (PubChem CID 58456587) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-butyl-2-(5,5-difluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione.
| Compound Name | 1-butyl-2-(5,5-difluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione |
|---|---|
| PubChem CID | 58456587 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-butyl-2-(5,5-difluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione |
| SMILES | CCCCn1c(CCCCC(F)F)cc(=O)c2c1CC(=O)NC2=O |
| InChI | InChI=1S/C17H22F2N2O3/c1-2-3-8-21-11(6-4-5-7-14(18)19)9-13(22)16-12(21)10-15(23)20-17(16)24/h9,14H,2-8,10H2,1H3,(H,20,23,24) |
| InChIKey | KZPVKXJMLZMMKO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|