C13H15FN2O3 — CID 58456593
2-butyl-1-(fluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione (PubChem CID 58456593) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-butyl-1-(fluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione.
| Compound Name | 2-butyl-1-(fluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione |
|---|---|
| PubChem CID | 58456593 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-butyl-1-(fluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione |
| SMILES | CCCCc1cc(=O)c2c(n1CF)CC(=O)NC2=O |
| InChI | InChI=1S/C13H15FN2O3/c1-2-3-4-8-5-10(17)12-9(16(8)7-14)6-11(18)15-13(12)19/h5H,2-4,6-7H2,1H3,(H,15,18,19) |
| InChIKey | ZSDSMDNDEMWJAY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|