C17H23FN2O3 — CID 58456603
1-butyl-2-(5-fluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione (PubChem CID 58456603) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-butyl-2-(5-fluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione.
| Compound Name | 1-butyl-2-(5-fluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione |
|---|---|
| PubChem CID | 58456603 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-butyl-2-(5-fluoropentyl)-8H-1,6-naphthyridine-4,5,7-trione |
| SMILES | CCCCn1c(CCCCCF)cc(=O)c2c1CC(=O)NC2=O |
| InChI | InChI=1S/C17H23FN2O3/c1-2-3-9-20-12(7-5-4-6-8-18)10-14(21)16-13(20)11-15(22)19-17(16)23/h10H,2-9,11H2,1H3,(H,19,22,23) |
| InChIKey | PSVIQHVWWQJGRG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|