C13H14F2N2O3 — CID 58456607
2-butyl-1-(difluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione (PubChem CID 58456607) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-butyl-1-(difluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione.
| Compound Name | 2-butyl-1-(difluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione |
|---|---|
| PubChem CID | 58456607 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-butyl-1-(difluoromethyl)-8H-1,6-naphthyridine-4,5,7-trione |
| SMILES | CCCCc1cc(=O)c2c(n1C(F)F)CC(=O)NC2=O |
| InChI | InChI=1S/C13H14F2N2O3/c1-2-3-4-7-5-9(18)11-8(17(7)13(14)15)6-10(19)16-12(11)20/h5,13H,2-4,6H2,1H3,(H,16,19,20) |
| InChIKey | GRXZMWRBLPLOBF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|