About 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole
2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole (PubChem CID 58456620) has the molecular formula C16H17N
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole.
Molecular Properties
| Compound Name | 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole |
| PubChem CID | 58456620 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole |
| SMILES | C=c1c2ccccc2c(=C)n1C1C=CCCC1 |
| InChI | InChI=1S/C16H17N/c1-12-15-10-6-7-11-16(15)13(2)17(12)14-8-4-3-5-9-14/h4,6-8,10-11,14H,1-3,5,9H2 |
| InChIKey | NXGJIBSALNBMMW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole?
The IUPAC name of 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole (CID 58456620) is 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole.
What is the SMILES notation for 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole?
The canonical SMILES for 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole is C=c1c2ccccc2c(=C)n1C1C=CCCC1.
What is the InChIKey of 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole?
The InChIKey is NXGJIBSALNBMMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N/c1-12-15-10-6-7-11-16(15)13(2)17(12)14-8-4-3-5-9-14/h4,6-8,10-11,14H,1-3,5,9H2.
What are the key properties of 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole?
2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole has a molecular weight of 223.32 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-2-en-1-yl-1,3-dimethylideneisoindole is sourced from PubChem (CID 58456620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).