C21H20ClN7O5 — CID 58457031
(4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1-methylimidazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione (PubChem CID 58457031) has the molecular formula C21H20ClN7O5 and a molecular weight of 485.89 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1-methylimidazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1-methylimidazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 58457031 |
| Molecular Formula | C21H20ClN7O5 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1-methylimidazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(nc4c(-c5nccn5C)noc4c3Cl)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C21H20ClN7O5/c1-8-7-29-14-10(6-21(16(29)9(2)33-8)18(30)25-20(32)26-19(21)31)24-12-13(17-23-4-5-28(17)3)27-34-15(12)11(14)22/h4-5,8-9,16H,6-7H2,1-3H3,(H2,25,26,30,31,32)/t8-,9+,16-/m1/s1 |
| InChIKey | ZYGQRIPEPFBYDM-YNEJBJPTSA-N |
| XLogP | 1.17 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|