C20H17ClN6O5S — CID 58457040
(4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1,3-thiazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione (PubChem CID 58457040) has the molecular formula C20H17ClN6O5S and a molecular weight of 488.91 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1,3-thiazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1,3-thiazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 58457040 |
| Molecular Formula | C20H17ClN6O5S |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-(1,3-thiazol-2-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(nc4c(-c5nccs5)noc4c3Cl)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C20H17ClN6O5S/c1-7-6-27-13-9(23-11-12(16-22-3-4-33-16)26-32-14(11)10(13)21)5-20(15(27)8(2)31-7)17(28)24-19(30)25-18(20)29/h3-4,7-8,15H,5-6H2,1-2H3,(H2,24,25,28,29,30)/t7-,8+,15-/m1/s1 |
| InChIKey | YXMRPTNKUBGVMH-VGZKNDNBSA-N |
| XLogP | 1.89 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|