C22H19ClN6O5 — CID 58457069
(4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-4-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione (PubChem CID 58457069) has the molecular formula C22H19ClN6O5 and a molecular weight of 482.88 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-4-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-4-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 58457069 |
| Molecular Formula | C22H19ClN6O5 |
| Molecular Weight | 482.88 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-4',6'-dimethyl-13'-pyridin-4-ylspiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(nc4c(-c5ccncc5)noc4c3Cl)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C22H19ClN6O5/c1-9-8-29-16-12(7-22(18(29)10(2)33-9)19(30)26-21(32)27-20(22)31)25-15-14(11-3-5-24-6-4-11)28-34-17(15)13(16)23/h3-6,9-10,18H,7-8H2,1-2H3,(H2,26,27,30,31,32)/t9-,10+,18-/m1/s1 |
| InChIKey | FXNYDQUBEWWQKM-AUSHCKSDSA-N |
| XLogP | 1.83 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.88 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|