C24H23FN4O5S — CID 58457098
(4R,6S,7S)-17-fluoro-4,6-dimethyl-13-[2-(1,3-thiazol-2-yl)ethyl]spiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione (PubChem CID 58457098) has the molecular formula C24H23FN4O5S and a molecular weight of 498.54 g/mol. Its IUPAC name is (4R,6S,7S)-17-fluoro-4,6-dimethyl-13-[2-(1,3-thiazol-2-yl)ethyl]spiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione.
| Compound Name | (4R,6S,7S)-17-fluoro-4,6-dimethyl-13-[2-(1,3-thiazol-2-yl)ethyl]spiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione |
|---|---|
| PubChem CID | 58457098 |
| Molecular Formula | C24H23FN4O5S |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (4R,6S,7S)-17-fluoro-4,6-dimethyl-13-[2-(1,3-thiazol-2-yl)ethyl]spiro[5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene-8,3'-piperidine]-2',4',6'-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(CCc5nccs5)noc4c3F)CC3(C(=O)CC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C24H23FN4O5S/c1-11-10-29-20-13(9-24(22(29)12(2)33-11)16(30)8-17(31)27-23(24)32)7-14-15(28-34-21(14)19(20)25)3-4-18-26-5-6-35-18/h5-7,11-12,22H,3-4,8-10H2,1-2H3,(H,27,31,32)/t11-,12+,22-,24?/m1/s1 |
| InChIKey | ITBXHAFQEZBMLT-ORTOMEQGSA-N |
| XLogP | 2.35 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|