C21H18FN5O5S — CID 58457100
(4'R,6'S,7'S)-17'-fluoro-4',6'-dimethyl-13'-(1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione (PubChem CID 58457100) has the molecular formula C21H18FN5O5S and a molecular weight of 471.47 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-fluoro-4',6'-dimethyl-13'-(1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione.
| Compound Name | (4'R,6'S,7'S)-17'-fluoro-4',6'-dimethyl-13'-(1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
|---|---|
| PubChem CID | 58457100 |
| Molecular Formula | C21H18FN5O5S |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (4'R,6'S,7'S)-17'-fluoro-4',6'-dimethyl-13'-(1,3-thiazol-5-yl)spiro[1,3-diazinane-5,8'-5,15-dioxa-2,14-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16),13-tetraene]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3c(cc4c(-c5cncs5)noc4c3F)CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C21H18FN5O5S/c1-8-6-27-15-10(3-11-14(12-5-23-7-33-12)26-32-16(11)13(15)22)4-21(17(27)9(2)31-8)18(28)24-20(30)25-19(21)29/h3,5,7-9,17H,4,6H2,1-2H3,(H2,24,25,28,29,30)/t8-,9+,17-/m1/s1 |
| InChIKey | SQDSWGQSOYDJPW-KSRUKNBBSA-N |
| XLogP | 1.98 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|