C20H21ClN6O6 — CID 58457182
(4'R,6'S,7'S)-17'-chloro-N-ethyl-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide (PubChem CID 58457182) has the molecular formula C20H21ClN6O6 and a molecular weight of 476.88 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-N-ethyl-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-N-ethyl-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide |
|---|---|
| PubChem CID | 58457182 |
| Molecular Formula | C20H21ClN6O6 |
| Molecular Weight | 476.88 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-N-ethyl-4',6'-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide |
| SMILES | CCNC(=O)c1noc2c(Cl)c3c(nc12)CC1(C(=O)NC(=O)NC1=O)[C@H]1[C@H](C)O[C@H](C)CN31 |
| InChI | InChI=1S/C20H21ClN6O6/c1-4-22-16(28)12-11-14(33-26-12)10(21)13-9(23-11)5-20(17(29)24-19(31)25-18(20)30)15-8(3)32-7(2)6-27(13)15/h7-8,15H,4-6H2,1-3H3,(H,22,28)(H2,24,25,29,30,31)/t7-,8+,15-/m1/s1 |
| InChIKey | LXWWGDMZJZNTAM-VGZKNDNBSA-N |
| XLogP | 0.52 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.88 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|