C19H19ClN6O6 — CID 58457188
(4'R,6'S,7'S)-17'-chloro-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide (PubChem CID 58457188) has the molecular formula C19H19ClN6O6 and a molecular weight of 462.85 g/mol. Its IUPAC name is (4'R,6'S,7'S)-17'-chloro-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide.
| Compound Name | (4'R,6'S,7'S)-17'-chloro-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide |
|---|---|
| PubChem CID | 58457188 |
| Molecular Formula | C19H19ClN6O6 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (4'R,6'S,7'S)-17'-chloro-N,4',6'-trimethyl-2,4,6-trioxospiro[1,3-diazinane-5,8'-5,15-dioxa-2,11,14-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),11,13,16-tetraene]-13'-carboxamide |
| SMILES | CNC(=O)c1noc2c(Cl)c3c(nc12)CC1(C(=O)NC(=O)NC1=O)[C@H]1[C@H](C)O[C@H](C)CN31 |
| InChI | InChI=1S/C19H19ClN6O6/c1-6-5-26-12-8(22-10-11(15(27)21-3)25-32-13(10)9(12)20)4-19(14(26)7(2)31-6)16(28)23-18(30)24-17(19)29/h6-7,14H,4-5H2,1-3H3,(H,21,27)(H2,23,24,28,29,30)/t6-,7+,14-/m1/s1 |
| InChIKey | KFRZFWRNTZMYGG-FHZAEYJHSA-N |
| XLogP | 0.13 |
| TPSA | 155.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|