C20H38ClN3 — CID 58457308
N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]ethane-1,2-diamine (PubChem CID 58457308) has the molecular formula C20H38ClN3 and a molecular weight of 356.00 g/mol. Its IUPAC name is N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]ethane-1,2-diamine.
| Compound Name | N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 58457308 |
| Molecular Formula | C20H38ClN3 |
| Molecular Weight | 356.00 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | N'-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]ethane-1,2-diamine |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)C(C)(C)C1)NCCN |
| InChI | InChI=1S/C20H38ClN3/c1-15(2)19(23-11-10-22)13-24-12-9-18(20(3,4)14-24)16-5-7-17(21)8-6-16/h5,7,15-19,23H,6,8-14,22H2,1-4H3/t16?,17?,18?,19-/m0/s1 |
| InChIKey | YSXOINGGCQXEKF-LFVBFMBRSA-N |
| XLogP | 3.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.00 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|