C28H45ClN2O — CID 58457341
3-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]adamantan-1-ol (PubChem CID 58457341) has the molecular formula C28H45ClN2O and a molecular weight of 461.13 g/mol. Its IUPAC name is 3-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]adamantan-1-ol.
| Compound Name | 3-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]adamantan-1-ol |
|---|---|
| PubChem CID | 58457341 |
| Molecular Formula | C28H45ClN2O |
| Molecular Weight | 461.13 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 3-[2-[[(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methylbutan-2-yl]amino]ethyl]adamantan-1-ol |
| SMILES | CC(C)[C@H](CN1CCC(C2=CCC(Cl)C=C2)CC1)NCCC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C28H45ClN2O/c1-20(2)26(18-31-11-7-24(8-12-31)23-3-5-25(29)6-4-23)30-10-9-27-14-21-13-22(15-27)17-28(32,16-21)19-27/h3-5,20-22,24-26,30,32H,6-19H2,1-2H3/t21?,22?,25?,26-,27?,28?/m0/s1 |
| InChIKey | LOMTVMAQFJOHFQ-USOGFYNCSA-N |
| XLogP | 5.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.13 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|