C24H41ClN2O — CID 58457370
(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-2-(cyclopentylmethylamino)-3-methylbutan-1-one (PubChem CID 58457370) has the molecular formula C24H41ClN2O and a molecular weight of 409.06 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-2-(cyclopentylmethylamino)-3-methylbutan-1-one.
| Compound Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-2-(cyclopentylmethylamino)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 58457370 |
| Molecular Formula | C24H41ClN2O |
| Molecular Weight | 409.06 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-2-(cyclopentylmethylamino)-3-methylbutan-1-one |
| SMILES | CC(C)[C@@H](NCC1CCCC1)C(=O)N1CCC(C2C=CC(Cl)CC2)C(C)(C)C1 |
| InChI | InChI=1S/C24H41ClN2O/c1-17(2)22(26-15-18-7-5-6-8-18)23(28)27-14-13-21(24(3,4)16-27)19-9-11-20(25)12-10-19/h9,11,17-22,26H,5-8,10,12-16H2,1-4H3/t19?,20?,21?,22-/m1/s1 |
| InChIKey | YUQNNTRUIGGUCJ-YMOXTTMHSA-N |
| XLogP | 5.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.06 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|