C23H42ClN3O — CID 58457522
1-tert-butyl-3-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]urea (PubChem CID 58457522) has the molecular formula C23H42ClN3O and a molecular weight of 412.06 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]urea |
|---|---|
| PubChem CID | 58457522 |
| Molecular Formula | C23H42ClN3O |
| Molecular Weight | 412.06 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | 1-tert-butyl-3-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]urea |
| SMILES | CC(C)[C@H](CN1CCC(C2=CCC(Cl)CC2)C(C)(C)C1)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H42ClN3O/c1-16(2)20(25-21(28)26-22(3,4)5)14-27-13-12-19(23(6,7)15-27)17-8-10-18(24)11-9-17/h8,16,18-20H,9-15H2,1-7H3,(H2,25,26,28)/t18?,19?,20-/m0/s1 |
| InChIKey | MDDYLEPFYVFIQP-MHJFOBGBSA-N |
| XLogP | 5.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.06 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|