C27H51ClN4 — CID 58457541
5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-N-propan-2-ylpiperidin-2-amine (PubChem CID 58457541) has the molecular formula C27H51ClN4 and a molecular weight of 467.19 g/mol. Its IUPAC name is 5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-N-propan-2-ylpiperidin-2-amine.
| Compound Name | 5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-N-propan-2-ylpiperidin-2-amine |
|---|---|
| PubChem CID | 58457541 |
| Molecular Formula | C27H51ClN4 |
| Molecular Weight | 467.19 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | 5-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]-N-propan-2-ylpiperidin-2-amine |
| SMILES | CC(C)NC1CCC(CN[C@@H](CN2CCC(C3C=CC(Cl)CC3)C(C)(C)C2)C(C)C)CN1 |
| InChI | InChI=1S/C27H51ClN4/c1-19(2)25(29-15-21-7-12-26(30-16-21)31-20(3)4)17-32-14-13-24(27(5,6)18-32)22-8-10-23(28)11-9-22/h8,10,19-26,29-31H,7,9,11-18H2,1-6H3/t21?,22?,23?,24?,25-,26?/m0/s1 |
| InChIKey | KOEMVUIVZDQTAC-BXVMBYABSA-N |
| XLogP | 4.85 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.19 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|