C27H48ClN3O2 — CID 58457555
1-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[4-(hydroxymethyl)cyclohexyl]methyl]urea (PubChem CID 58457555) has the molecular formula C27H48ClN3O2 and a molecular weight of 482.15 g/mol. Its IUPAC name is 1-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[4-(hydroxymethyl)cyclohexyl]methyl]urea.
| Compound Name | 1-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[4-(hydroxymethyl)cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 58457555 |
| Molecular Formula | C27H48ClN3O2 |
| Molecular Weight | 482.15 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | 1-[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[4-(hydroxymethyl)cyclohexyl]methyl]urea |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)C(C)(C)C1)NC(=O)NCC1CCC(CO)CC1 |
| InChI | InChI=1S/C27H48ClN3O2/c1-19(2)25(30-26(33)29-15-20-5-7-21(17-32)8-6-20)16-31-14-13-24(27(3,4)18-31)22-9-11-23(28)12-10-22/h9,11,19-25,32H,5-8,10,12-18H2,1-4H3,(H2,29,30,33)/t20?,21?,22?,23?,24?,25-/m0/s1 |
| InChIKey | VTNXZGQRQTZVOT-MPILJKFISA-N |
| XLogP | 5.03 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.15 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|